N-(3-Chloropropyl)morpholine CAS:7357-67-7
N-(3-Chloropropyl)morpholine is primarily utilized as a versatile building block in organic synthesis, especially in the pharmaceutical industry. Its morpholine structure allows for the introduction of diverse functional groups, facilitating the development of bioactive compounds that can interact with biological targets. This reactivity makes it valuable in creating potential therapeutic agents, including antihypertensives, analgesics, and antimicrobial drugs. Moreover, the compound's chloroalkyl group aids in the formation of more complex structures through nucleophilic substitution reactions, which are crucial for developing drug candidates. As such, N-(3-chloropropyl)morpholine may be involved in synthesizing novel compounds that exhibit enhanced efficacy against specific diseases. In addition to medicinal applications, this compound is also explored in the agrochemical sector, where it serves as an intermediate in the synthesis of pesticides and herbicides. Its ability to modulate biological activity can help design targeted solutions to protect crops from pests and enhance agricultural productivity. Furthermore, N-(3-chloropropyl)morpholine may find applications in the production of specialty chemicals and surfactants due to its morpholine component, expanding its utility across various industrial sectors. Overall, this compound's versatility positions it as a significant player in both research and commercial applications.



Composition | C7H14ClNO |
Assay | 99% |
Appearance | white powder |
CAS No. | 7357-67-7 |
Packing | Small and bulk |
Shelf Life | 2 years |
Storage | Store in cool and dry area |
Certification | ISO. |