The Belt and Road: Cooperation, Harmony and Win-Win
products

Products

  • 1,3,5-Triazine-2,4,6-(1H,3H,5H)-trithione trisodium salt CAS:17766-26-6

    1,3,5-Triazine-2,4,6-(1H,3H,5H)-trithione trisodium salt CAS:17766-26-6

    1,3,5-Triazine-2,4,6-(1H,3H,5H)-trithione trisodium salt is a sodium salt of a triazine derivative featuring a unique trithione structure. This compound exhibits strong chelating properties and is characterized by its stability and solubility in water, making it useful in various applications. The presence of sulfur and nitrogen in its structure enhances its reactivity and ability to form complexes with metal ions. Due to these characteristics, it is often used as a reagent in chemical synthesis, agriculture, and environmental applications.

  • 5-Methyl-2-nitrobenzoic acid CAS:3113-72-2

    5-Methyl-2-nitrobenzoic acid CAS:3113-72-2

    5-Methyl-2-nitrobenzoic acid is an aromatic compound characterized by the presence of a nitro group and a methyl group on the benzene ring, specifically at the 2 and 5 positions, respectively. This compound is part of the benzoic acid family and exhibits unique chemical properties due to its functional groups. It is primarily utilized in organic synthesis, particularly as a building block for various chemical reactions. Furthermore, its derivatives are explored for potential biological activities, making it of interest in pharmaceuticals and agrochemicals.

     

  • 5-Nitroisatin CAS:611-09-6

    5-Nitroisatin CAS:611-09-6

    5-Nitroisatin is a chemical compound derived from isatin, featuring a nitro group at the 5-position of the indole ring. This compound exhibits distinct properties due to the presence of both the isatin and nitro functional groups, making it a valuable intermediate in organic synthesis. 5-Nitroisatin displays various biological activities, including antimicrobial and anticancer properties, rendering it of interest in medicinal chemistry. Its unique chemical structure allows for further modifications, enabling the development of new derivatives with enhanced pharmacological effects.

     

  • 2-Nitro-4-methylsulfonylbenzoic acid CAS:110964-79-9

    2-Nitro-4-methylsulfonylbenzoic acid CAS:110964-79-9

    2-Nitro-4-methylsulfonylbenzoic acid is an organic compound featuring a benzoic acid core with both a nitro group and a methylsulfonyl group attached at the ortho and para positions, respectively. This compound typically appears as a yellow crystalline solid and is known for its unique chemical properties, which stem from the presence of the nitro and sulfonyl groups. It serves as an important intermediate in various chemical syntheses and has applications in pharmaceuticals, agrochemicals, and materials science.

     

  • 4-Methylsulphonylbenzoic acid CAS:4052-30-6

    4-Methylsulphonylbenzoic acid CAS:4052-30-6

    4-Methylsulphonylbenzoic acid is an organic compound characterized by a benzoic acid structure with a methylsulfonyl group attached to the para position of the benzene ring. This compound appears as a white crystalline powder and is soluble in polar solvents. It serves as an important intermediate in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. The unique properties afforded by the methylsulfonyl group enhance its chemical reactivity, making it valuable in organic synthesis and development.

  • Thianaphthene CAS:95-15-8

    Thianaphthene CAS:95-15-8

    Thianaphthene is a heterocyclic organic compound characterized by its fused bicyclic structure containing both sulfur and carbon atoms. Its molecular formula is C10H8S, and it resembles naphthalene with the incorporation of a sulfur atom in its structure. Typically appearing as a yellow to brown solid, thianaphthene has attracted interest due to its unique electronic properties and potential applications in materials science. The presence of sulfur introduces specific reactivity that can be exploited in various chemical reactions, making it valuable for further chemical synthesis and functional material development.

  • N-(3-Chloropropyl)morpholine CAS:7357-67-7

    N-(3-Chloropropyl)morpholine CAS:7357-67-7

    N-(3-Chloropropyl)morpholine is an organic compound with the molecular formula C9H10ClN, characterized by a morpholine ring and a 3-chloropropyl substituent. This compound typically appears as a clear to pale yellow liquid. The presence of both the morpholine moiety and the chloroalkyl group contributes to its unique chemical properties, making it a useful intermediate in organic synthesis. Due to its reactivity, it has garnered interest in various fields, particularly in medicinal chemistry and industrial applications.

  • N-(2-Methyl-5-nitrophenyl)-4-(pyridin-3-yl)pyrimidin-2-amine CAS:152460-09-8

    N-(2-Methyl-5-nitrophenyl)-4-(pyridin-3-yl)pyrimidin-2-amine CAS:152460-09-8

    N-(2-Methyl-5-nitrophenyl)-4-(pyridin-3-yl)pyrimidin-2-amine is a complex organic compound characterized by its unique combination of functional groups. It features a pyrimidine core substituted with an amine group, a 5-nitrophenyl moiety, and a pyridine ring. With the molecular formula C15H15N5O2, this compound typically appears as a solid and has garnered interest in medicinal chemistry due to its potential bioactive properties. Its structure allows for interactions with various biological targets, making it a promising candidate for drug development and research.

  • difluoromethanesulphonyl chloride CAS:1512-30-7

    difluoromethanesulphonyl chloride CAS:1512-30-7

    Difluoromethanesulphonyl chloride, with the chemical formula CF2ClSO2Cl, is an organosulfur compound characterized by the presence of both fluoro and chlorosulfate functional groups. It typically appears as a colorless to pale yellow liquid and is known for its reactivity and ability to act as a sulfonylating agent. This compound is primarily utilized in organic synthesis, particularly in the preparation of sulfonamides and other sulfur-containing compounds. Its distinctive properties make it valuable in various chemical transformations, contributing to the development of diverse applications in pharmaceuticals and agrochemicals.

  • 9,10-Dihydro-9-oxa-10-phosphaphenanthrene 10-oxide CAS:35948-25-5

    9,10-Dihydro-9-oxa-10-phosphaphenanthrene 10-oxide CAS:35948-25-5

    9,10-Dihydro-9-oxa-10-phosphaphenanthrene 10-oxide, commonly referred to as a phosphaphenanthrene compound, is a heterocyclic compound containing both phosphorus and oxygen within its structure. This compound features a phenanthrene backbone with an oxa substituent and a phosphorus atom, forming a stable ring system. It typically appears as a solid and is recognized for its unique properties, including thermal stability and potential reactivity in various chemical transformations. Due to these characteristics, it has garnered interest in materials science and organic synthesis.

  • 5-Methoxy-2-nitrobenzoic acid CAS:1882-69-5

    5-Methoxy-2-nitrobenzoic acid CAS:1882-69-5

    5-Methoxy-2-nitrobenzoic acid is an organic compound with the chemical formula C9H9N O4. It features a benzoic acid structure substituted with a methoxy group (-OCH3) at the 5-position and a nitro group (-NO2) at the 2-position of the aromatic ring. This compound appears as a pale yellow solid and is known for its unique chemical properties that enable it to participate in various reactions. As an intermediate in organic synthesis, it plays a significant role in the production of pharmaceuticals, agrochemicals, and other specialty chemicals.

  • 5-Bromo-2-fluorobenzaldehyde CAS:93777-26-5

    5-Bromo-2-fluorobenzaldehyde CAS:93777-26-5

    5-Bromo-2-fluorobenzaldehyde is an organic compound with the molecular formula C7H4BrFNO. It features a benzaldehyde functional group (-CHO) along with a bromine atom at the 5-position and a fluorine atom at the 2-position of the benzene ring. This compound typically appears as a pale yellow to off-white solid or liquid. Its unique structure, which includes both halogen substituents and an aldehyde group, makes it valuable in various chemical reactions and synthetic applications, especially in the realms of pharmaceuticals and materials science.