S-(-)-2-ChloropropionicAcid CAS:29617-66-1

S-(-)-2-Chloropropionic Acid serves diverse roles across different domains. In the realm of organic synthesis, it serves as a valuable building block for the preparation of pharmaceutical intermediates, agrochemicals, and specialty chemicals. Its chiral nature makes it particularly beneficial in the synthesis of enantiomerically pure compounds, which are essential in drug development and the production of fine chemicals. Furthermore, this compound is used in the manufacturing of polymers and polymer additives, contributing to the development of advanced materials with tailored properties. In the agricultural sector, it plays a role in the creation of crop protection agents and plant growth regulators. Additionally, S-(-)-2-Chloropropionic Acid has applications in academic research, where it serves as a reagent in organic chemistry investigations and as a reference compound for analytical studies. Its versatile utility underscores its significance in the realms of chemical synthesis, material science, agriculture, and scientific exploration.